About 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide
4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide (PubChem CID 5419735) has the molecular formula C15H13F3N2O2S
and a molecular weight of 342.34 g/mol. Its IUPAC name is 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide |
| PubChem CID | 5419735 |
| Molecular Formula | C15H13F3N2O2S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C(\c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F3N2O2S/c1-11-7-9-13(10-8-11)23(21,22)20-19-14(15(16,17)18)12-5-3-2-4-6-12/h2-10,20H,1H3/b19-14+ |
| InChIKey | QACLRZKZKDFMCQ-XMHGGMMESA-N |
| XLogP | 3.24 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide?
The IUPAC name of 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide (CID 5419735) is 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide.
What is the SMILES notation for 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide?
The canonical SMILES for 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide is Cc1ccc(S(=O)(=O)N/N=C(\c2ccccc2)C(F)(F)F)cc1.
What is the InChIKey of 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide?
The InChIKey is QACLRZKZKDFMCQ-XMHGGMMESA-N. The full InChI is InChI=1S/C15H13F3N2O2S/c1-11-7-9-13(10-8-11)23(21,22)20-19-14(15(16,17)18)12-5-3-2-4-6-12/h2-10,20H,1H3/b19-14+.
What are the key properties of 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide?
4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide has a molecular weight of 342.34 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-[(E)-(2,2,2-trifluoro-1-phenylethylidene)amino]benzenesulfonamide is sourced from PubChem (CID 5419735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).