C18H23ClI3N3O8 — CID 54197438
3-N-chloro-1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,4,6-triiodo-5-[(2-methoxyacetyl)-methylamino]benzene-1,3-dicarboxamide (PubChem CID 54197438) has the molecular formula C18H23ClI3N3O8 and a molecular weight of 825.56 g/mol. Its IUPAC name is 3-N-chloro-1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,4,6-triiodo-5-[(2-methoxyacetyl)-methylamino]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-chloro-1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,4,6-triiodo-5-[(2-methoxyacetyl)-methylamino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 54197438 |
| Molecular Formula | C18H23ClI3N3O8 |
| Molecular Weight | 825.56 g/mol |
| Exact Mass | 824.83 |
| IUPAC Name | 3-N-chloro-1-N,3-N-bis(1,3-dihydroxypropan-2-yl)-2,4,6-triiodo-5-[(2-methoxyacetyl)-methylamino]benzene-1,3-dicarboxamide |
| SMILES | COCC(=O)N(C)c1c(I)c(C(=O)NC(CO)CO)c(I)c(C(=O)N(Cl)C(CO)CO)c1I |
| InChI | InChI=1S/C18H23ClI3N3O8/c1-24(10(30)7-33-2)16-14(21)11(17(31)23-8(3-26)4-27)13(20)12(15(16)22)18(32)25(19)9(5-28)6-29/h8-9,26-29H,3-7H2,1-2H3,(H,23,31) |
| InChIKey | PMVOJHWGWYTORV-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 159.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.56 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|