C20H17F23O3 — CID 54197855
[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluoro-2-hydroxy-12-(trifluoromethyl)tridecyl] 2,2-dimethylbutanoate (PubChem CID 54197855) has the molecular formula C20H17F23O3 and a molecular weight of 742.31 g/mol. Its IUPAC name is [4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluoro-2-hydroxy-12-(trifluoromethyl)tridecyl] 2,2-dimethylbutanoate.
| Compound Name | [4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluoro-2-hydroxy-12-(trifluoromethyl)tridecyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 54197855 |
| Molecular Formula | C20H17F23O3 |
| Molecular Weight | 742.31 g/mol |
| Exact Mass | 742.08 |
| IUPAC Name | [4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluoro-2-hydroxy-12-(trifluoromethyl)tridecyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H17F23O3/c1-4-9(2,3)8(45)46-6-7(44)5-10(21,22)12(24,25)14(28,29)16(32,33)18(36,37)17(34,35)15(30,31)13(26,27)11(23,19(38,39)40)20(41,42)43/h7,44H,4-6H2,1-3H3 |
| InChIKey | PNDAIQOMJJHAER-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.31 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|