C11H18N2O5 — CID 54198074
5-(2,3-dihydroxypropyl)-5-(2-methylpropyl)-1,3-diazinane-2,4,6-trione (PubChem CID 54198074) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropyl)-5-(2-methylpropyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2,3-dihydroxypropyl)-5-(2-methylpropyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 54198074 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 5-(2,3-dihydroxypropyl)-5-(2-methylpropyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)CC1(CC(O)CO)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C11H18N2O5/c1-6(2)3-11(4-7(15)5-14)8(16)12-10(18)13-9(11)17/h6-7,14-15H,3-5H2,1-2H3,(H2,12,13,16,17,18) |
| InChIKey | PNGVJCHFMKMWDC-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|