About [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate
[4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate (PubChem CID 54198885) has the molecular formula C22H25F2NO2
and a molecular weight of 373.44 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate |
| PubChem CID | 54198885 |
| Molecular Formula | C22H25F2NO2 |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate |
| SMILES | N#CC=CC1CCC(C(=O)OC2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H25F2NO2/c23-20-12-9-18(14-21(20)24)16-7-10-19(11-8-16)27-22(26)17-5-3-15(4-6-17)2-1-13-25/h1-2,9,12,14-17,19H,3-8,10-11H2 |
| InChIKey | PNUSTDGSNOTUQO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate?
The IUPAC name of [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate (CID 54198885) is [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate.
What is the SMILES notation for [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate?
The canonical SMILES for [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate is N#CC=CC1CCC(C(=O)OC2CCC(c3ccc(F)c(F)c3)CC2)CC1.
What is the InChIKey of [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate?
The InChIKey is PNUSTDGSNOTUQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25F2NO2/c23-20-12-9-18(14-21(20)24)16-7-10-19(11-8-16)27-22(26)17-5-3-15(4-6-17)2-1-13-25/h1-2,9,12,14-17,19H,3-8,10-11H2.
What are the key properties of [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate?
[4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate has a molecular weight of 373.44 g/mol, XLogP of 5.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-difluorophenyl)cyclohexyl] 4-(2-cyanoethenyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 54198885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).