About [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate
[4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate (PubChem CID 54199015) has the molecular formula C10H20O5S
and a molecular weight of 252.33 g/mol. Its IUPAC name is [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate.
Molecular Properties
| Compound Name | [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate |
| PubChem CID | 54199015 |
| Molecular Formula | C10H20O5S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate |
| SMILES | CC(C)(CCOS(C)(=O)=O)CC1OCCO1 |
| InChI | InChI=1S/C10H20O5S/c1-10(2,4-5-15-16(3,11)12)8-9-13-6-7-14-9/h9H,4-8H2,1-3H3 |
| InChIKey | PNXBGEHRACETAY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate?
The IUPAC name of [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate (CID 54199015) is [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate.
What is the SMILES notation for [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate?
The canonical SMILES for [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate is CC(C)(CCOS(C)(=O)=O)CC1OCCO1.
What is the InChIKey of [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate?
The InChIKey is PNXBGEHRACETAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O5S/c1-10(2,4-5-15-16(3,11)12)8-9-13-6-7-14-9/h9H,4-8H2,1-3H3.
What are the key properties of [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate?
[4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate has a molecular weight of 252.33 g/mol, XLogP of 1.14, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3-dioxolan-2-yl)-3,3-dimethylbutyl] methanesulfonate is sourced from PubChem (CID 54199015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).