About 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one
4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one (PubChem CID 54199826) has the molecular formula C7H12N2O4
and a molecular weight of 188.18 g/mol. Its IUPAC name is 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one |
| PubChem CID | 54199826 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one |
| SMILES | O=c1n(CCO)cc(O)n1CCO |
| InChI | InChI=1S/C7H12N2O4/c10-3-1-8-5-6(12)9(2-4-11)7(8)13/h5,10-12H,1-4H2 |
| InChIKey | POLAJVXTOFIAEH-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one?
The IUPAC name of 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one (CID 54199826) is 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one.
What is the SMILES notation for 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one?
The canonical SMILES for 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one is O=c1n(CCO)cc(O)n1CCO.
What is the InChIKey of 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one?
The InChIKey is POLAJVXTOFIAEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O4/c10-3-1-8-5-6(12)9(2-4-11)7(8)13/h5,10-12H,1-4H2.
What are the key properties of 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one?
4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one has a molecular weight of 188.18 g/mol, XLogP of -1.66, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1,3-bis(2-hydroxyethyl)imidazol-2-one is sourced from PubChem (CID 54199826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).