About 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate
5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate (PubChem CID 54200139) has the molecular formula C16H16O7S
and a molecular weight of 352.36 g/mol. Its IUPAC name is 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate.
Molecular Properties
| Compound Name | 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate |
| PubChem CID | 54200139 |
| Molecular Formula | C16H16O7S |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate |
| SMILES | C=CCOC(=O)C=C(C(=O)C(=O)OCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16O7S/c1-3-10-23-14(17)11-13(15(18)16(19)22-4-2)24(20,21)12-8-6-5-7-9-12/h3,5-9,11H,1,4,10H2,2H3 |
| InChIKey | POQNATNMXXYXOG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate?
The IUPAC name of 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate (CID 54200139) is 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate.
What is the SMILES notation for 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate?
The canonical SMILES for 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate is C=CCOC(=O)C=C(C(=O)C(=O)OCC)S(=O)(=O)c1ccccc1.
What is the InChIKey of 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate?
The InChIKey is POQNATNMXXYXOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O7S/c1-3-10-23-14(17)11-13(15(18)16(19)22-4-2)24(20,21)12-8-6-5-7-9-12/h3,5-9,11H,1,4,10H2,2H3.
What are the key properties of 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate?
5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate has a molecular weight of 352.36 g/mol, XLogP of 1.21, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-ethyl 1-O-prop-2-enyl 3-(benzenesulfonyl)-4-oxopent-2-enedioate is sourced from PubChem (CID 54200139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).