About (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one
(4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one (PubChem CID 54200185) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one |
| PubChem CID | 54200185 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one |
| SMILES | C[C@H]1CC(=O)N[C@@H]1CCC1OCCO1 |
| InChI | InChI=1S/C10H17NO3/c1-7-6-9(12)11-8(7)2-3-10-13-4-5-14-10/h7-8,10H,2-6H2,1H3,(H,11,12)/t7-,8+/m0/s1 |
| InChIKey | PORHWWZIFBMLCU-JGVFFNPUSA-N |
| XLogP | 0.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one?
The IUPAC name of (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one (CID 54200185) is (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one.
What is the SMILES notation for (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one?
The canonical SMILES for (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one is C[C@H]1CC(=O)N[C@@H]1CCC1OCCO1.
What is the InChIKey of (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one?
The InChIKey is PORHWWZIFBMLCU-JGVFFNPUSA-N. The full InChI is InChI=1S/C10H17NO3/c1-7-6-9(12)11-8(7)2-3-10-13-4-5-14-10/h7-8,10H,2-6H2,1H3,(H,11,12)/t7-,8+/m0/s1.
What are the key properties of (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one?
(4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one has a molecular weight of 199.25 g/mol, XLogP of 0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-5-[2-(1,3-dioxolan-2-yl)ethyl]-4-methylpyrrolidin-2-one is sourced from PubChem (CID 54200185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).