About 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid
2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid (PubChem CID 54200300) has the molecular formula C18H20N4O4
and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid.
Molecular Properties
| Compound Name | 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid |
| PubChem CID | 54200300 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid |
| SMILES | Cc1cc(-c2nccc(/N=C/C(C(=O)O)C(=O)OC(C)C)n2)cc(C)n1 |
| InChI | InChI=1S/C18H20N4O4/c1-10(2)26-18(25)14(17(23)24)9-20-15-5-6-19-16(22-15)13-7-11(3)21-12(4)8-13/h5-10,14H,1-4H3,(H,23,24)/b20-9+ |
| InChIKey | QFEWYMNSHGMSGM-AWQFTUOYSA-N |
| XLogP | 2.51 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid?
The IUPAC name of 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid (CID 54200300) is 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid.
What is the SMILES notation for 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid?
The canonical SMILES for 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid is Cc1cc(-c2nccc(/N=C/C(C(=O)O)C(=O)OC(C)C)n2)cc(C)n1.
What is the InChIKey of 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid?
The InChIKey is QFEWYMNSHGMSGM-AWQFTUOYSA-N. The full InChI is InChI=1S/C18H20N4O4/c1-10(2)26-18(25)14(17(23)24)9-20-15-5-6-19-16(22-15)13-7-11(3)21-12(4)8-13/h5-10,14H,1-4H3,(H,23,24)/b20-9+.
What are the key properties of 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid?
2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid has a molecular weight of 356.38 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2,6-dimethyl-4-pyridinyl)pyrimidin-4-yl]iminomethyl]-3-oxo-3-propan-2-yloxypropanoic acid is sourced from PubChem (CID 54200300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).