C21H15Cl2NO3 — CID 54200602
1-[2-(4,5-dichloro-2-methoxyphenoxy)-3-pyridinyl]-3-phenylprop-2-en-1-one (PubChem CID 54200602) has the molecular formula C21H15Cl2NO3 and a molecular weight of 400.26 g/mol. Its IUPAC name is 1-[2-(4,5-dichloro-2-methoxyphenoxy)-3-pyridinyl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[2-(4,5-dichloro-2-methoxyphenoxy)-3-pyridinyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 54200602 |
| Molecular Formula | C21H15Cl2NO3 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 1-[2-(4,5-dichloro-2-methoxyphenoxy)-3-pyridinyl]-3-phenylprop-2-en-1-one |
| SMILES | COc1cc(Cl)c(Cl)cc1Oc1ncccc1C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C21H15Cl2NO3/c1-26-19-12-16(22)17(23)13-20(19)27-21-15(8-5-11-24-21)18(25)10-9-14-6-3-2-4-7-14/h2-13H,1H3 |
| InChIKey | POYQHCMNHKQCHV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|