C18H21NO10S — CID 54201255
(5R,8S)-8-ethoxycarbonyloxy-14,16-dihydroxy-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-5-carboxylic acid (PubChem CID 54201255) has the molecular formula C18H21NO10S and a molecular weight of 443.43 g/mol. Its IUPAC name is (5R,8S)-8-ethoxycarbonyloxy-14,16-dihydroxy-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-5-carboxylic acid.
| Compound Name | (5R,8S)-8-ethoxycarbonyloxy-14,16-dihydroxy-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 54201255 |
| Molecular Formula | C18H21NO10S |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | (5R,8S)-8-ethoxycarbonyloxy-14,16-dihydroxy-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-5-carboxylic acid |
| SMILES | CCOC(=O)O[C@H]1COC(=O)c2c(C)c(O)cc(O)c2CSC[C@@H](C(=O)O)NC1=O |
| InChI | InChI=1S/C18H21NO10S/c1-3-27-18(26)29-13-5-28-17(25)14-8(2)11(20)4-12(21)9(14)6-30-7-10(16(23)24)19-15(13)22/h4,10,13,20-21H,3,5-7H2,1-2H3,(H,19,22)(H,23,24)/t10-,13-/m0/s1 |
| InChIKey | PPKKTAYGWHVSGZ-GWCFXTLKSA-N |
| XLogP | 0.92 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |