C14H13ClF3NO2 — CID 54201505
4-[3-chloro-5-(trifluoromethyl)phenyl]-2-ethyl-5-(methylamino)furan-3-ol (PubChem CID 54201505) has the molecular formula C14H13ClF3NO2 and a molecular weight of 319.71 g/mol. Its IUPAC name is 4-[3-chloro-5-(trifluoromethyl)phenyl]-2-ethyl-5-(methylamino)furan-3-ol.
| Compound Name | 4-[3-chloro-5-(trifluoromethyl)phenyl]-2-ethyl-5-(methylamino)furan-3-ol |
|---|---|
| PubChem CID | 54201505 |
| Molecular Formula | C14H13ClF3NO2 |
| Molecular Weight | 319.71 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-[3-chloro-5-(trifluoromethyl)phenyl]-2-ethyl-5-(methylamino)furan-3-ol |
| SMILES | CCc1oc(NC)c(-c2cc(Cl)cc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C14H13ClF3NO2/c1-3-10-12(20)11(13(19-2)21-10)7-4-8(14(16,17)18)6-9(15)5-7/h4-6,19-20H,3H2,1-2H3 |
| InChIKey | PPOPILVWQVZRAR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.71 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |