About 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene
1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene (PubChem CID 54202072) has the molecular formula C36H50O5
and a molecular weight of 562.79 g/mol. Its IUPAC name is 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene.
Molecular Properties
| Compound Name | 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene |
| PubChem CID | 54202072 |
| Molecular Formula | C36H50O5 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.37 |
| IUPAC Name | 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene |
| SMILES | Cc1cc(Cc2ccc(OC(C)C)cc2OC(C)C)c(OC(C)C)c(Cc2ccc(OC(C)C)cc2OC(C)C)c1 |
| InChI | InChI=1S/C36H50O5/c1-22(2)37-32-14-12-28(34(20-32)39-24(5)6)18-30-16-27(11)17-31(36(30)41-26(9)10)19-29-13-15-33(38-23(3)4)21-35(29)40-25(7)8/h12-17,20-26H,18-19H2,1-11H3 |
| InChIKey | PPYLSDSVPXCWRN-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene?
The IUPAC name of 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene (CID 54202072) is 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene.
What is the SMILES notation for 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene?
The canonical SMILES for 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene is Cc1cc(Cc2ccc(OC(C)C)cc2OC(C)C)c(OC(C)C)c(Cc2ccc(OC(C)C)cc2OC(C)C)c1.
What is the InChIKey of 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene?
The InChIKey is PPYLSDSVPXCWRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H50O5/c1-22(2)37-32-14-12-28(34(20-32)39-24(5)6)18-30-16-27(11)17-31(36(30)41-26(9)10)19-29-13-15-33(38-23(3)4)21-35(29)40-25(7)8/h12-17,20-26H,18-19H2,1-11H3.
What are the key properties of 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene?
1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene has a molecular weight of 562.79 g/mol, XLogP of 9.11, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[[2,4-di(propan-2-yloxy)phenyl]methyl]-5-methyl-2-propan-2-yloxybenzene is sourced from PubChem (CID 54202072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).