About tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate
tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate (PubChem CID 54202662) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate.
Molecular Properties
| Compound Name | tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate |
| PubChem CID | 54202662 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate |
| SMILES | CCC(=O)C(C)(C)C(=CC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C14H24O4/c1-8-10(15)14(5,6)11(17-7)9-12(16)18-13(2,3)4/h9H,8H2,1-7H3 |
| InChIKey | PQISDEFVFHKVIV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate?
The IUPAC name of tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate (CID 54202662) is tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate.
What is the SMILES notation for tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate?
The canonical SMILES for tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate is CCC(=O)C(C)(C)C(=CC(=O)OC(C)(C)C)OC.
What is the InChIKey of tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate?
The InChIKey is PQISDEFVFHKVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4/c1-8-10(15)14(5,6)11(17-7)9-12(16)18-13(2,3)4/h9H,8H2,1-7H3.
What are the key properties of tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate?
tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate has a molecular weight of 256.34 g/mol, XLogP of 2.86, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-methoxy-4,4-dimethyl-5-oxohept-2-enoate is sourced from PubChem (CID 54202662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).