About 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine
3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine (PubChem CID 54202696) has the molecular formula C22H17N3
and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine.
Molecular Properties
| Compound Name | 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine |
| PubChem CID | 54202696 |
| Molecular Formula | C22H17N3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine |
| SMILES | C(=Cc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)c1cccnc1 |
| InChI | InChI=1S/C22H17N3/c1-3-9-18(10-4-1)21-22(19-11-5-2-6-12-19)25-20(24-21)14-13-17-8-7-15-23-16-17/h1-16H,(H,24,25) |
| InChIKey | PQJIKUYXEVDFIJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine?
The IUPAC name of 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine (CID 54202696) is 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine.
What is the SMILES notation for 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine?
The canonical SMILES for 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine is C(=Cc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)c1cccnc1.
What is the InChIKey of 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine?
The InChIKey is PQJIKUYXEVDFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3/c1-3-9-18(10-4-1)21-22(19-11-5-2-6-12-19)25-20(24-21)14-13-17-8-7-15-23-16-17/h1-16H,(H,24,25).
What are the key properties of 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine?
3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine has a molecular weight of 323.40 g/mol, XLogP of 5.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4,5-diphenyl-1H-imidazol-2-yl)ethenyl]pyridine is sourced from PubChem (CID 54202696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).