C20H26N6O5S — CID 54202711
(2S,5R,6R)-6-[[2-[[2-(1,2-diaminoethylideneamino)acetyl]amino]-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 54202711) has the molecular formula C20H26N6O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is (2S,5R,6R)-6-[[2-[[2-(1,2-diaminoethylideneamino)acetyl]amino]-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-[[2-[[2-(1,2-diaminoethylideneamino)acetyl]amino]-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 54202711 |
| Molecular Formula | C20H26N6O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (2S,5R,6R)-6-[[2-[[2-(1,2-diaminoethylideneamino)acetyl]amino]-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)C(NC(=O)C/N=C(/N)CN)c3ccccc3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C20H26N6O5S/c1-20(2)15(19(30)31)26-17(29)14(18(26)32-20)25-16(28)13(10-6-4-3-5-7-10)24-12(27)9-23-11(22)8-21/h3-7,13-15,18H,8-9,21H2,1-2H3,(H2,22,23)(H,24,27)(H,25,28)(H,30,31)/t13?,14-,15+,18-/m1/s1 |
| InChIKey | PQJOMYCAYJBJFY-KRWWSPQJSA-N |
| XLogP | -1.21 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|