C39H24F6O4 — CID 54203395
1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-3-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 54203395) has the molecular formula C39H24F6O4 and a molecular weight of 670.61 g/mol. Its IUPAC name is 1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-3-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-3-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54203395 |
| Molecular Formula | C39H24F6O4 |
| Molecular Weight | 670.61 g/mol |
| Exact Mass | 670.16 |
| IUPAC Name | 1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-3-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccccc1C=CC(=O)c1ccc2c(c1)C(c1ccc(OC(F)=C(F)F)cc1)(c1ccc(OC(F)=C(F)F)cc1)c1ccccc1-2 |
| InChI | InChI=1S/C39H24F6O4/c1-47-34-9-5-2-6-23(34)11-21-33(46)24-10-20-30-29-7-3-4-8-31(29)39(32(30)22-24,25-12-16-27(17-13-25)48-37(44)35(40)41)26-14-18-28(19-15-26)49-38(45)36(42)43/h2-22H,1H3 |
| InChIKey | PQUTXZXXVPVKAS-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.61 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|