C39H42N4O2 — CID 54203427
1-methyl-3,4-bis(1,2,5-trimethylindol-3-yl)pyrrole-2,5-dione;1,2,3,5-tetramethylindole (PubChem CID 54203427) has the molecular formula C39H42N4O2 and a molecular weight of 598.79 g/mol. Its IUPAC name is 1-methyl-3,4-bis(1,2,5-trimethylindol-3-yl)pyrrole-2,5-dione;1,2,3,5-tetramethylindole.
| Compound Name | 1-methyl-3,4-bis(1,2,5-trimethylindol-3-yl)pyrrole-2,5-dione;1,2,3,5-tetramethylindole |
|---|---|
| PubChem CID | 54203427 |
| Molecular Formula | C39H42N4O2 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 1-methyl-3,4-bis(1,2,5-trimethylindol-3-yl)pyrrole-2,5-dione;1,2,3,5-tetramethylindole |
| SMILES | Cc1ccc2c(c1)c(C)c(C)n2C.Cc1ccc2c(c1)c(C1=C(c3c(C)n(C)c4ccc(C)cc34)C(=O)N(C)C1=O)c(C)n2C |
| InChI | InChI=1S/C27H27N3O2.C12H15N/c1-14-8-10-20-18(12-14)22(16(3)28(20)5)24-25(27(32)30(7)26(24)31)23-17(4)29(6)21-11-9-15(2)13-19(21)23;1-8-5-6-12-11(7-8)9(2)10(3)13(12)4/h8-13H,1-7H3;5-7H,1-4H3 |
| InChIKey | PQVHZANHPUVLHZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 52.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|