C22H39N3O2 — CID 54203518
3,6-dibutoxy-N,N-dibutyl-4-diazocyclohexa-1,5-dien-1-amine (PubChem CID 54203518) has the molecular formula C22H39N3O2 and a molecular weight of 377.57 g/mol. Its IUPAC name is 3,6-dibutoxy-N,N-dibutyl-4-diazocyclohexa-1,5-dien-1-amine.
| Compound Name | 3,6-dibutoxy-N,N-dibutyl-4-diazocyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 54203518 |
| Molecular Formula | C22H39N3O2 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.30 |
| IUPAC Name | 3,6-dibutoxy-N,N-dibutyl-4-diazocyclohexa-1,5-dien-1-amine |
| SMILES | CCCCOC1=CC(=[N+]=[N-])C(OCCCC)C=C1N(CCCC)CCCC |
| InChI | InChI=1S/C22H39N3O2/c1-5-9-13-25(14-10-6-2)20-18-21(26-15-11-7-3)19(24-23)17-22(20)27-16-12-8-4/h17-18,21H,5-16H2,1-4H3 |
| InChIKey | PQWWFGDVFNLGPJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 58.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|