C7H14NO+ — CID 54203737
3,3-diethyl-2H-1,3-oxazol-3-ium (PubChem CID 54203737) has the molecular formula C7H14NO+ and a molecular weight of 128.19 g/mol. Its IUPAC name is 3,3-diethyl-2H-1,3-oxazol-3-ium.
| Compound Name | 3,3-diethyl-2H-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 54203737 |
| Molecular Formula | C7H14NO+ |
| Molecular Weight | 128.19 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | 3,3-diethyl-2H-1,3-oxazol-3-ium |
| SMILES | CC[N+]1(CC)C=COC1 |
| InChI | InChI=1S/C7H14NO/c1-3-8(4-2)5-6-9-7-8/h5-6H,3-4,7H2,1-2H3/q+1 |
| InChIKey | CJEKLSYHCVCAJQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|