C8H4F15N — CID 54203807
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorooctan-1-amine (PubChem CID 54203807) has the molecular formula C8H4F15N and a molecular weight of 399.10 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorooctan-1-amine.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorooctan-1-amine |
|---|---|
| PubChem CID | 54203807 |
| Molecular Formula | C8H4F15N |
| Molecular Weight | 399.10 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorooctan-1-amine |
| SMILES | NC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C8H4F15N/c9-1-2(10,11)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24/h1,24H2 |
| InChIKey | PRCHXWLOTUMVAE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.10 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|