C36H43N2+ — CID 54203899
3-butyl-2-[5-(3,3-dimethyl-1-propylindol-2-ylidene)penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium (PubChem CID 54203899) has the molecular formula C36H43N2+ and a molecular weight of 503.75 g/mol. Its IUPAC name is 3-butyl-2-[5-(3,3-dimethyl-1-propylindol-2-ylidene)penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium.
| Compound Name | 3-butyl-2-[5-(3,3-dimethyl-1-propylindol-2-ylidene)penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 54203899 |
| Molecular Formula | C36H43N2+ |
| Molecular Weight | 503.75 g/mol |
| Exact Mass | 503.34 |
| IUPAC Name | 3-butyl-2-[5-(3,3-dimethyl-1-propylindol-2-ylidene)penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium |
| SMILES | CCCC[N+]1=C(C=CC=CC=C2N(CCC)c3ccccc3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C36H43N2/c1-7-9-26-38-31-24-23-27-17-13-14-18-28(27)34(31)36(5,6)33(38)22-12-10-11-21-32-35(3,4)29-19-15-16-20-30(29)37(32)25-8-2/h10-24H,7-9,25-26H2,1-6H3/q+1 |
| InChIKey | UIAFVESVKYDYRK-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.75 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|