About [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane
[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane (PubChem CID 54203936) has the molecular formula C15H30O3Si
and a molecular weight of 286.49 g/mol. Its IUPAC name is [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane.
Molecular Properties
| Compound Name | [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane |
| PubChem CID | 54203936 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane |
| SMILES | CCO[Si](C)(CC=C(C)CCC1OC1(C)C)OCC |
| InChI | InChI=1S/C15H30O3Si/c1-7-16-19(6,17-8-2)12-11-13(3)9-10-14-15(4,5)18-14/h11,14H,7-10,12H2,1-6H3 |
| InChIKey | PREQQKYORYXACQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane?
The IUPAC name of [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane (CID 54203936) is [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane.
What is the SMILES notation for [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane?
The canonical SMILES for [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane is CCO[Si](C)(CC=C(C)CCC1OC1(C)C)OCC.
What is the InChIKey of [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane?
The InChIKey is PREQQKYORYXACQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3Si/c1-7-16-19(6,17-8-2)12-11-13(3)9-10-14-15(4,5)18-14/h11,14H,7-10,12H2,1-6H3.
What are the key properties of [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane?
[5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane has a molecular weight of 286.49 g/mol, XLogP of 4.04, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl]-diethoxy-methylsilane is sourced from PubChem (CID 54203936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).