About 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole
5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole (PubChem CID 54204560) has the molecular formula C24H21ClN2O4S
and a molecular weight of 468.96 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole |
| PubChem CID | 54204560 |
| Molecular Formula | C24H21ClN2O4S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole |
| SMILES | COc1ccc(-c2cc(-c3ccc(Cl)cc3)n(-c3ccc(S(C)(=O)=O)cc3)n2)cc1OC |
| InChI | InChI=1S/C24H21ClN2O4S/c1-30-23-13-6-17(14-24(23)31-2)21-15-22(16-4-7-18(25)8-5-16)27(26-21)19-9-11-20(12-10-19)32(3,28)29/h4-15H,1-3H3 |
| InChIKey | PRPIPELCSBISMP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole?
The IUPAC name of 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole (CID 54204560) is 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole.
What is the SMILES notation for 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole?
The canonical SMILES for 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole is COc1ccc(-c2cc(-c3ccc(Cl)cc3)n(-c3ccc(S(C)(=O)=O)cc3)n2)cc1OC.
What is the InChIKey of 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole?
The InChIKey is PRPIPELCSBISMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21ClN2O4S/c1-30-23-13-6-17(14-24(23)31-2)21-15-22(16-4-7-18(25)8-5-16)27(26-21)19-9-11-20(12-10-19)32(3,28)29/h4-15H,1-3H3.
What are the key properties of 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole?
5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole has a molecular weight of 468.96 g/mol, XLogP of 5.28, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(4-methylsulfonylphenyl)pyrazole is sourced from PubChem (CID 54204560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).