About 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one
4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one (PubChem CID 54204694) has the molecular formula C24H32N2O5
and a molecular weight of 428.53 g/mol. Its IUPAC name is 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one.
Molecular Properties
| Compound Name | 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one |
| PubChem CID | 54204694 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one |
| SMILES | CCCCOc1c(OCC=C(C)CCC=C(C)C)c(=O)n(C)c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C24H32N2O5/c1-6-7-14-30-22-20-12-11-19(26(28)29)16-21(20)25(5)24(27)23(22)31-15-13-18(4)10-8-9-17(2)3/h9,11-13,16H,6-8,10,14-15H2,1-5H3 |
| InChIKey | PRRJCMRDPBRJLF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one?
The IUPAC name of 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one (CID 54204694) is 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one.
What is the SMILES notation for 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one?
The canonical SMILES for 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one is CCCCOc1c(OCC=C(C)CCC=C(C)C)c(=O)n(C)c2cc([N+](=O)[O-])ccc12.
What is the InChIKey of 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one?
The InChIKey is PRRJCMRDPBRJLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32N2O5/c1-6-7-14-30-22-20-12-11-19(26(28)29)16-21(20)25(5)24(27)23(22)31-15-13-18(4)10-8-9-17(2)3/h9,11-13,16H,6-8,10,14-15H2,1-5H3.
What are the key properties of 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one?
4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one has a molecular weight of 428.53 g/mol, XLogP of 5.70, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-3-(3,7-dimethylocta-2,6-dienoxy)-1-methyl-7-nitroquinolin-2-one is sourced from PubChem (CID 54204694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).