About 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol
2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol (PubChem CID 54205026) has the molecular formula C11H15N5S
and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol.
Molecular Properties
| Compound Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol |
| PubChem CID | 54205026 |
| Molecular Formula | C11H15N5S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol |
| SMILES | Nc1nc(N(CCS)Cc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C11H15N5S/c12-10-13-11(15-14-10)16(6-7-17)8-9-4-2-1-3-5-9/h1-5,17H,6-8H2,(H3,12,13,14,15) |
| InChIKey | PRXOHXHNCHZCOZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol?
The IUPAC name of 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol (CID 54205026) is 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol.
What is the SMILES notation for 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol?
The canonical SMILES for 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol is Nc1nc(N(CCS)Cc2ccccc2)n[nH]1.
What is the InChIKey of 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol?
The InChIKey is PRXOHXHNCHZCOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5S/c12-10-13-11(15-14-10)16(6-7-17)8-9-4-2-1-3-5-9/h1-5,17H,6-8H2,(H3,12,13,14,15).
What are the key properties of 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol?
2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol has a molecular weight of 249.34 g/mol, XLogP of 1.32, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-1H-1,2,4-triazol-3-yl)-benzylamino]ethanethiol is sourced from PubChem (CID 54205026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).