C21H27N3O5S2 — CID 54205029
N-[5-(heptylsulfonylmethyl)-1,2-oxazol-3-yl]-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide (PubChem CID 54205029) has the molecular formula C21H27N3O5S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[5-(heptylsulfonylmethyl)-1,2-oxazol-3-yl]-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide.
| Compound Name | N-[5-(heptylsulfonylmethyl)-1,2-oxazol-3-yl]-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 54205029 |
| Molecular Formula | C21H27N3O5S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-[5-(heptylsulfonylmethyl)-1,2-oxazol-3-yl]-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide |
| SMILES | CCCCCCCS(=O)(=O)Cc1cc(NC(=O)C2C(=O)c3ccccc3SN2C)no1 |
| InChI | InChI=1S/C21H27N3O5S2/c1-3-4-5-6-9-12-31(27,28)14-15-13-18(23-29-15)22-21(26)19-20(25)16-10-7-8-11-17(16)30-24(19)2/h7-8,10-11,13,19H,3-6,9,12,14H2,1-2H3,(H,22,23,26) |
| InChIKey | PRXQJDJJHZQGBV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|