C18H21NO3S2 — CID 54205183
1-cyclopropyl-2-(dimethylaminomethylidene)-3-(5-methylsulfanyl-2,3-dihydro-1,4-benzoxathiin-8-yl)propane-1,3-dione (PubChem CID 54205183) has the molecular formula C18H21NO3S2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-cyclopropyl-2-(dimethylaminomethylidene)-3-(5-methylsulfanyl-2,3-dihydro-1,4-benzoxathiin-8-yl)propane-1,3-dione.
| Compound Name | 1-cyclopropyl-2-(dimethylaminomethylidene)-3-(5-methylsulfanyl-2,3-dihydro-1,4-benzoxathiin-8-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 54205183 |
| Molecular Formula | C18H21NO3S2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 1-cyclopropyl-2-(dimethylaminomethylidene)-3-(5-methylsulfanyl-2,3-dihydro-1,4-benzoxathiin-8-yl)propane-1,3-dione |
| SMILES | CSc1ccc(C(=O)C(=CN(C)C)C(=O)C2CC2)c2c1SCCO2 |
| InChI | InChI=1S/C18H21NO3S2/c1-19(2)10-13(15(20)11-4-5-11)16(21)12-6-7-14(23-3)18-17(12)22-8-9-24-18/h6-7,10-11H,4-5,8-9H2,1-3H3 |
| InChIKey | PRZYNAOJJAOIIU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|