C17H38O2Si — CID 54205248
dimethoxy-(2,4,4,6,6-pentamethylheptyl)-propan-2-ylsilane (PubChem CID 54205248) has the molecular formula C17H38O2Si and a molecular weight of 302.58 g/mol. Its IUPAC name is dimethoxy-(2,4,4,6,6-pentamethylheptyl)-propan-2-ylsilane.
| Compound Name | dimethoxy-(2,4,4,6,6-pentamethylheptyl)-propan-2-ylsilane |
|---|---|
| PubChem CID | 54205248 |
| Molecular Formula | C17H38O2Si |
| Molecular Weight | 302.58 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | dimethoxy-(2,4,4,6,6-pentamethylheptyl)-propan-2-ylsilane |
| SMILES | CO[Si](CC(C)CC(C)(C)CC(C)(C)C)(OC)C(C)C |
| InChI | InChI=1S/C17H38O2Si/c1-14(2)20(18-9,19-10)12-15(3)11-17(7,8)13-16(4,5)6/h14-15H,11-13H2,1-10H3 |
| InChIKey | PSBBSFJQPQOXHV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|