C22H26N4O4S2 — CID 54205300
N-[2-[4-(2-bicyclo[2.2.1]hept-5-enylmethylcarbamoylsulfamoyl)phenyl]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 54205300) has the molecular formula C22H26N4O4S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-[2-[4-(2-bicyclo[2.2.1]hept-5-enylmethylcarbamoylsulfamoyl)phenyl]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[4-(2-bicyclo[2.2.1]hept-5-enylmethylcarbamoylsulfamoyl)phenyl]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 54205300 |
| Molecular Formula | C22H26N4O4S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-[2-[4-(2-bicyclo[2.2.1]hept-5-enylmethylcarbamoylsulfamoyl)phenyl]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)NCCc1ccc(S(=O)(=O)NC(=O)NCC2CC3C=CC2C3)cc1 |
| InChI | InChI=1S/C22H26N4O4S2/c1-14-20(31-13-25-14)21(27)23-9-8-15-3-6-19(7-4-15)32(29,30)26-22(28)24-12-18-11-16-2-5-17(18)10-16/h2-7,13,16-18H,8-12H2,1H3,(H,23,27)(H2,24,26,28) |
| InChIKey | PSBXMXAGRJQSDU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|