C29H42N4O6 — CID 54205391
(2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-[butyl-[4-(dimethylamino)butyl]amino]-2-oxoethyl]-2-[2-(1,3-oxazol-2-yl)ethyl]pyrrolidine-3-carboxylic acid (PubChem CID 54205391) has the molecular formula C29H42N4O6 and a molecular weight of 542.68 g/mol. Its IUPAC name is (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-[butyl-[4-(dimethylamino)butyl]amino]-2-oxoethyl]-2-[2-(1,3-oxazol-2-yl)ethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-[butyl-[4-(dimethylamino)butyl]amino]-2-oxoethyl]-2-[2-(1,3-oxazol-2-yl)ethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54205391 |
| Molecular Formula | C29H42N4O6 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | (2R,3S,4S)-4-(1,3-benzodioxol-5-yl)-1-[2-[butyl-[4-(dimethylamino)butyl]amino]-2-oxoethyl]-2-[2-(1,3-oxazol-2-yl)ethyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCCCN(CCCCN(C)C)C(=O)CN1C[C@H](c2ccc3c(c2)OCO3)[C@H](C(=O)O)[C@H]1CCc1ncco1 |
| InChI | InChI=1S/C29H42N4O6/c1-4-5-14-32(15-7-6-13-31(2)3)27(34)19-33-18-22(21-8-10-24-25(17-21)39-20-38-24)28(29(35)36)23(33)9-11-26-30-12-16-37-26/h8,10,12,16-17,22-23,28H,4-7,9,11,13-15,18-20H2,1-3H3,(H,35,36)/t22-,23-,28+/m1/s1 |
| InChIKey | PSDGRYSKMGWIHF-MRJKTFCFSA-N |
| XLogP | 3.48 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|