About ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate
ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate (PubChem CID 54205606) has the molecular formula C27H48O5Si2
and a molecular weight of 508.85 g/mol. Its IUPAC name is ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate |
| PubChem CID | 54205606 |
| Molecular Formula | C27H48O5Si2 |
| Molecular Weight | 508.85 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(O)CCC(c2ccc(O[Si](C)(C)C(C)(C)C)cc2O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C27H48O5Si2/c1-12-30-24(28)27(29)17-15-20(16-18-27)22-14-13-21(31-33(8,9)25(2,3)4)19-23(22)32-34(10,11)26(5,6)7/h13-14,19-20,29H,12,15-18H2,1-11H3 |
| InChIKey | PSGOIBNYGRKGLW-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.85 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate (CID 54205606) is ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate is CCOC(=O)C1(O)CCC(c2ccc(O[Si](C)(C)C(C)(C)C)cc2O[Si](C)(C)C(C)(C)C)CC1.
What is the InChIKey of ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate?
The InChIKey is PSGOIBNYGRKGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H48O5Si2/c1-12-30-24(28)27(29)17-15-20(16-18-27)22-14-13-21(31-33(8,9)25(2,3)4)19-23(22)32-34(10,11)26(5,6)7/h13-14,19-20,29H,12,15-18H2,1-11H3.
What are the key properties of ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate?
ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate has a molecular weight of 508.85 g/mol, XLogP of 7.41, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-1-hydroxycyclohexane-1-carboxylate is sourced from PubChem (CID 54205606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).