About 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid
2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid (PubChem CID 54205744) has the molecular formula C13H11F3N2O4
and a molecular weight of 316.24 g/mol. Its IUPAC name is 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid |
| PubChem CID | 54205744 |
| Molecular Formula | C13H11F3N2O4 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid |
| SMILES | NC(Cc1c(-c2ccc(C(F)(F)F)cc2)o[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C13H11F3N2O4/c14-13(15,16)7-3-1-6(2-4-7)10-8(11(19)18-22-10)5-9(17)12(20)21/h1-4,9H,5,17H2,(H,18,19)(H,20,21) |
| InChIKey | PSISXPDALZLKHO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid?
The IUPAC name of 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid (CID 54205744) is 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid.
What is the SMILES notation for 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid?
The canonical SMILES for 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid is NC(Cc1c(-c2ccc(C(F)(F)F)cc2)o[nH]c1=O)C(=O)O.
What is the InChIKey of 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid?
The InChIKey is PSISXPDALZLKHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O4/c14-13(15,16)7-3-1-6(2-4-7)10-8(11(19)18-22-10)5-9(17)12(20)21/h1-4,9H,5,17H2,(H,18,19)(H,20,21).
What are the key properties of 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid?
2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid has a molecular weight of 316.24 g/mol, XLogP of 1.61, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[3-oxo-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-yl]propanoic acid is sourced from PubChem (CID 54205744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).