About (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate
(4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate (PubChem CID 54206041) has the molecular formula C30H36O3
and a molecular weight of 444.62 g/mol. Its IUPAC name is (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate.
Molecular Properties
| Compound Name | (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate |
| PubChem CID | 54206041 |
| Molecular Formula | C30H36O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate |
| SMILES | CCCCCCc1ccc(OC(=O)c2ccc(-c3ccc(OCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H36O3/c1-3-5-7-8-10-24-11-19-29(20-12-24)33-30(31)27-15-13-25(14-16-27)26-17-21-28(22-18-26)32-23-9-6-4-2/h11-22H,3-10,23H2,1-2H3 |
| InChIKey | PSNJQZKYVVRNRB-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate?
The IUPAC name of (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate (CID 54206041) is (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate.
What is the SMILES notation for (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate?
The canonical SMILES for (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate is CCCCCCc1ccc(OC(=O)c2ccc(-c3ccc(OCCCCC)cc3)cc2)cc1.
What is the InChIKey of (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate?
The InChIKey is PSNJQZKYVVRNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H36O3/c1-3-5-7-8-10-24-11-19-29(20-12-24)33-30(31)27-15-13-25(14-16-27)26-17-21-28(22-18-26)32-23-9-6-4-2/h11-22H,3-10,23H2,1-2H3.
What are the key properties of (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate?
(4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate has a molecular weight of 444.62 g/mol, XLogP of 8.26, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hexylphenyl) 4-(4-pentoxyphenyl)benzoate is sourced from PubChem (CID 54206041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).