C19H40N2 — CID 54206184
1-methyl-4-(2,2,3,3,4,4,5,5-octamethylhexyl)piperazine (PubChem CID 54206184) has the molecular formula C19H40N2 and a molecular weight of 296.54 g/mol. Its IUPAC name is 1-methyl-4-(2,2,3,3,4,4,5,5-octamethylhexyl)piperazine.
| Compound Name | 1-methyl-4-(2,2,3,3,4,4,5,5-octamethylhexyl)piperazine |
|---|---|
| PubChem CID | 54206184 |
| Molecular Formula | C19H40N2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | 1-methyl-4-(2,2,3,3,4,4,5,5-octamethylhexyl)piperazine |
| SMILES | CN1CCN(CC(C)(C)C(C)(C)C(C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H40N2/c1-16(2,3)18(6,7)19(8,9)17(4,5)15-21-13-11-20(10)12-14-21/h11-15H2,1-10H3 |
| InChIKey | PSQDFQWFLIOOOI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |