C21H14N4OS — CID 54206320
4-[4-(indol-1-ylamino)thieno[3,2-d]pyrimidin-6-yl]benzaldehyde (PubChem CID 54206320) has the molecular formula C21H14N4OS and a molecular weight of 370.44 g/mol. Its IUPAC name is 4-[4-(indol-1-ylamino)thieno[3,2-d]pyrimidin-6-yl]benzaldehyde.
| Compound Name | 4-[4-(indol-1-ylamino)thieno[3,2-d]pyrimidin-6-yl]benzaldehyde |
|---|---|
| PubChem CID | 54206320 |
| Molecular Formula | C21H14N4OS |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 4-[4-(indol-1-ylamino)thieno[3,2-d]pyrimidin-6-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2cc3ncnc(Nn4ccc5ccccc54)c3s2)cc1 |
| InChI | InChI=1S/C21H14N4OS/c26-12-14-5-7-16(8-6-14)19-11-17-20(27-19)21(23-13-22-17)24-25-10-9-15-3-1-2-4-18(15)25/h1-13H,(H,22,23,24) |
| InChIKey | PSSNUNIEKBRLCT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|