C34H28N2O5S — CID 54206734
dibenzhydryl (6S)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,3-dicarboxylate (PubChem CID 54206734) has the molecular formula C34H28N2O5S and a molecular weight of 576.67 g/mol. Its IUPAC name is dibenzhydryl (6S)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,3-dicarboxylate.
| Compound Name | dibenzhydryl (6S)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 54206734 |
| Molecular Formula | C34H28N2O5S |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | dibenzhydryl (6S)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,3-dicarboxylate |
| SMILES | NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(C(=O)OC(c3ccccc3)c3ccccc3)CS[C@@H]12 |
| InChI | InChI=1S/C34H28N2O5S/c35-27-31(37)36-28(34(39)41-30(24-17-9-3-10-18-24)25-19-11-4-12-20-25)26(21-42-32(27)36)33(38)40-29(22-13-5-1-6-14-22)23-15-7-2-8-16-23/h1-20,27,29-30,32H,21,35H2/t27?,32-/m0/s1 |
| InChIKey | PTABHEJTSJARTR-YCUNKVRLSA-N |
| XLogP | 5.15 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |