About N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine
N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine (PubChem CID 54206912) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine.
Molecular Properties
| Compound Name | N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine |
| PubChem CID | 54206912 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine |
| SMILES | CCN(CC)CC=C(C)C(OC)OC |
| InChI | InChI=1S/C11H23NO2/c1-6-12(7-2)9-8-10(3)11(13-4)14-5/h8,11H,6-7,9H2,1-5H3 |
| InChIKey | PTDCZNJKKZYCBJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine?
The IUPAC name of N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine (CID 54206912) is N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine.
What is the SMILES notation for N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine?
The canonical SMILES for N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine is CCN(CC)CC=C(C)C(OC)OC.
What is the InChIKey of N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine?
The InChIKey is PTDCZNJKKZYCBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-6-12(7-2)9-8-10(3)11(13-4)14-5/h8,11H,6-7,9H2,1-5H3.
What are the key properties of N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine?
N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine has a molecular weight of 201.31 g/mol, XLogP of 1.89, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4,4-dimethoxy-3-methylbut-2-en-1-amine is sourced from PubChem (CID 54206912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).