C14H24S2 — CID 54207017
5-butyl-2-(3,3-dimethylbut-1-ynyl)-1,3-dithiane (PubChem CID 54207017) has the molecular formula C14H24S2 and a molecular weight of 256.48 g/mol. Its IUPAC name is 5-butyl-2-(3,3-dimethylbut-1-ynyl)-1,3-dithiane.
| Compound Name | 5-butyl-2-(3,3-dimethylbut-1-ynyl)-1,3-dithiane |
|---|---|
| PubChem CID | 54207017 |
| Molecular Formula | C14H24S2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 5-butyl-2-(3,3-dimethylbut-1-ynyl)-1,3-dithiane |
| SMILES | CCCCC1CSC(C#CC(C)(C)C)SC1 |
| InChI | InChI=1S/C14H24S2/c1-5-6-7-12-10-15-13(16-11-12)8-9-14(2,3)4/h12-13H,5-7,10-11H2,1-4H3 |
| InChIKey | PTEVECZBYNOZAO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|