C12H13N5O3 — CID 54208197
(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 54208197) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 54208197 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-ethynyl-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | C#C[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C12H13N5O3/c1-2-6-9(19)7(3-18)20-12(6)17-5-16-8-10(13)14-4-15-11(8)17/h1,4-7,9,12,18-19H,3H2,(H2,13,14,15)/t6-,7-,9+,12-/m1/s1 |
| InChIKey | PUAXRPYBCYCQFX-PNFUHCLESA-N |
| XLogP | -1.09 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|