C14H11N — CID 54208249
4-azatricyclo[9.4.0.03,8]pentadeca-1,3(8),4,6,10,12,14-heptaene (PubChem CID 54208249) has the molecular formula C14H11N and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-azatricyclo[9.4.0.03,8]pentadeca-1,3(8),4,6,10,12,14-heptaene.
| Compound Name | 4-azatricyclo[9.4.0.03,8]pentadeca-1,3(8),4,6,10,12,14-heptaene |
|---|---|
| PubChem CID | 54208249 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 4-azatricyclo[9.4.0.03,8]pentadeca-1,3(8),4,6,10,12,14-heptaene |
| SMILES | C1=c2ccccc2=Cc2ncccc2C1 |
| InChI | InChI=1S/C14H11N/c1-2-5-13-10-14-12(6-3-9-15-14)8-7-11(13)4-1/h1-7,9-10H,8H2 |
| InChIKey | PUBPOEZCQYLQHD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |