About (1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid
(1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 54208319) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is (1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid.
Analyze (1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of (1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid (CID 54208319) is (1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for (1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for (1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid is O=C(O)[C@@]1(O)C=CC=C[C@H]1O.
What is the InChIKey of (1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is PUCYIVFXTPWJDD-IYSWYEEDSA-N. The full InChI is InChI=1S/C7H8O4/c8-5-3-1-2-4-7(5,11)6(9)10/h1-5,8,11H,(H,9,10)/t5-,7-/m1/s1.
What are the key properties of (1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid?
(1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 156.14 g/mol, XLogP of -0.71, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6R)-1,6-dihydroxycyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 54208319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).