C17H31N3O5 — CID 54208406
tert-butyl (2S)-2-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]piperazine-1-carboxylate (PubChem CID 54208406) has the molecular formula C17H31N3O5 and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54208406 |
| Molecular Formula | C17H31N3O5 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | tert-butyl (2S)-2-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]piperazine-1-carboxylate |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)[C@@H]1CNCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31N3O5/c1-11(2)8-12(9-14(21)19-24)15(22)13-10-18-6-7-20(13)16(23)25-17(3,4)5/h11-13,18,24H,6-10H2,1-5H3,(H,19,21)/t12-,13+/m1/s1 |
| InChIKey | PUEIQLLXWYYJEQ-OLZOCXBDSA-N |
| XLogP | 1.32 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|