About ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate
ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate (PubChem CID 54208764) has the molecular formula C27H25NO5
and a molecular weight of 443.50 g/mol. Its IUPAC name is ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate.
Molecular Properties
| Compound Name | ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate |
| PubChem CID | 54208764 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)C1(OC(=O)c3ccccc31)c1ccc(N(CC)CC)cc1O2 |
| InChI | InChI=1S/C27H25NO5/c1-4-28(5-2)18-12-13-21-24(16-18)32-23-14-11-17(25(29)31-6-3)15-22(23)27(21)20-10-8-7-9-19(20)26(30)33-27/h7-16H,4-6H2,1-3H3 |
| InChIKey | PUKVTQJSWWVOJZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate?
The IUPAC name of ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate (CID 54208764) is ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate.
What is the SMILES notation for ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate?
The canonical SMILES for ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate is CCOC(=O)c1ccc2c(c1)C1(OC(=O)c3ccccc31)c1ccc(N(CC)CC)cc1O2.
What is the InChIKey of ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate?
The InChIKey is PUKVTQJSWWVOJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25NO5/c1-4-28(5-2)18-12-13-21-24(16-18)32-23-14-11-17(25(29)31-6-3)15-22(23)27(21)20-10-8-7-9-19(20)26(30)33-27/h7-16H,4-6H2,1-3H3.
What are the key properties of ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate?
ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate has a molecular weight of 443.50 g/mol, XLogP of 5.28, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6'-(diethylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-carboxylate is sourced from PubChem (CID 54208764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).