About (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde
(2R)-3,4-dihydro-2H-chromene-2-carbaldehyde (PubChem CID 54208872) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde.
Molecular Properties
| Compound Name | (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde |
| PubChem CID | 54208872 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde |
| SMILES | O=C[C@H]1CCc2ccccc2O1 |
| InChI | InChI=1S/C10H10O2/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-4,7,9H,5-6H2/t9-/m1/s1 |
| InChIKey | PUMRUSBKNSBTAL-SECBINFHSA-N |
| XLogP | 1.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde?
The IUPAC name of (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde (CID 54208872) is (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde.
What is the SMILES notation for (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde?
The canonical SMILES for (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde is O=C[C@H]1CCc2ccccc2O1.
What is the InChIKey of (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde?
The InChIKey is PUMRUSBKNSBTAL-SECBINFHSA-N. The full InChI is InChI=1S/C10H10O2/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-4,7,9H,5-6H2/t9-/m1/s1.
What are the key properties of (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde?
(2R)-3,4-dihydro-2H-chromene-2-carbaldehyde has a molecular weight of 162.19 g/mol, XLogP of 1.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,4-dihydro-2H-chromene-2-carbaldehyde is sourced from PubChem (CID 54208872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).