C45H71NO6 — CID 54209408
[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-propanoyloxyethyl] 2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2,2,6,6-tetramethylpiperidin-4-yl)propanoate (PubChem CID 54209408) has the molecular formula C45H71NO6 and a molecular weight of 722.06 g/mol. Its IUPAC name is [2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-propanoyloxyethyl] 2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2,2,6,6-tetramethylpiperidin-4-yl)propanoate.
| Compound Name | [2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-propanoyloxyethyl] 2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2,2,6,6-tetramethylpiperidin-4-yl)propanoate |
|---|---|
| PubChem CID | 54209408 |
| Molecular Formula | C45H71NO6 |
| Molecular Weight | 722.06 g/mol |
| Exact Mass | 721.53 |
| IUPAC Name | [2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-propanoyloxyethyl] 2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2,2,6,6-tetramethylpiperidin-4-yl)propanoate |
| SMILES | CCC(=O)OC(COC(=O)C(C)(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C1CC(C)(C)NC(C)(C)C1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C45H71NO6/c1-19-35(47)52-34(27-20-30(39(2,3)4)36(48)31(21-27)40(5,6)7)26-51-38(50)45(18,29-24-43(14,15)46-44(16,17)25-29)28-22-32(41(8,9)10)37(49)33(23-28)42(11,12)13/h20-23,29,34,46,48-49H,19,24-26H2,1-18H3 |
| InChIKey | PUWKHLBONQCUMV-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.06 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |