C21H30F6O2Si — CID 54209651
6-(7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl)-1,1,1-trifluoro-2-(trifluoromethyl)hept-3-yn-2-ol (PubChem CID 54209651) has the molecular formula C21H30F6O2Si and a molecular weight of 456.54 g/mol. Its IUPAC name is 6-(7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl)-1,1,1-trifluoro-2-(trifluoromethyl)hept-3-yn-2-ol.
| Compound Name | 6-(7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl)-1,1,1-trifluoro-2-(trifluoromethyl)hept-3-yn-2-ol |
|---|---|
| PubChem CID | 54209651 |
| Molecular Formula | C21H30F6O2Si |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 6-(7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl)-1,1,1-trifluoro-2-(trifluoromethyl)hept-3-yn-2-ol |
| SMILES | CC(CC#CC(O)(C(F)(F)F)C(F)(F)F)C1=CCC2C(O[Si](C)(C)C)CCCC12C |
| InChI | InChI=1S/C21H30F6O2Si/c1-14(8-6-13-19(28,20(22,23)24)21(25,26)27)15-10-11-16-17(29-30(3,4)5)9-7-12-18(15,16)2/h10,14,16-17,28H,7-9,11-12H2,1-5H3 |
| InChIKey | PVARIMFOGYYGCP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|