C15H13N — CID 54209851
1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9,11,13-hexaene (PubChem CID 54209851) has the molecular formula C15H13N and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9,11,13-hexaene.
| Compound Name | 1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9,11,13-hexaene |
|---|---|
| PubChem CID | 54209851 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9,11,13-hexaene |
| SMILES | C1=CC2=C3C=CC=C4CC=CN(C2C=C1)C43 |
| InChI | InChI=1S/C15H13N/c1-2-9-14-12(7-1)13-8-3-5-11-6-4-10-16(14)15(11)13/h1-5,7-10,14-15H,6H2 |
| InChIKey | PVELHRFRFVUNPC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |