C24H28FN3O6S — CID 54209942
[4-(8-fluoro-4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)-1,3-dimethylpyrazol-5-yl] cyclohexanecarboxylate (PubChem CID 54209942) has the molecular formula C24H28FN3O6S and a molecular weight of 505.57 g/mol. Its IUPAC name is [4-(8-fluoro-4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)-1,3-dimethylpyrazol-5-yl] cyclohexanecarboxylate.
| Compound Name | [4-(8-fluoro-4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)-1,3-dimethylpyrazol-5-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 54209942 |
| Molecular Formula | C24H28FN3O6S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | [4-(8-fluoro-4-methoxyimino-5-methyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)-1,3-dimethylpyrazol-5-yl] cyclohexanecarboxylate |
| SMILES | CON=C1CCS(=O)(=O)c2c(F)cc(C(=O)c3c(C)nn(C)c3OC(=O)C3CCCCC3)c(C)c21 |
| InChI | InChI=1S/C24H28FN3O6S/c1-13-16(12-17(25)22-19(13)18(27-33-4)10-11-35(22,31)32)21(29)20-14(2)26-28(3)23(20)34-24(30)15-8-6-5-7-9-15/h12,15H,5-11H2,1-4H3 |
| InChIKey | PVGCKLDTACMOFQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 116.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|